CAS 1008956-65-7 is the registry number for 2–(3–Chloro–4–fluorobenzenesulfonamido)–3–phenylpropanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[(3-chloro-4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 1008956-65-7) is a chemical compound with the molecular formula C15H13ClFNO4S and a molecular weight of 357.8 g/mol. IUPAC name: 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: NJWNKXRKNANWCI-UHFFFAOYSA-N.
| Molecular formula | C15H13ClFNO4S |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid |
| InChIKey | NJWNKXRKNANWCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)F)Cl |
Computed by PubChem (NCBI)