Products 1008956-65-7

CAS 1008956-65-7 is the registry number for 2–(3–Chloro–4–fluorobenzenesulfonamido)–3–phenylpropanoic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[(3-chloro-4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid (CAS 1008956-65-7) is a chemical compound with the molecular formula C15H13ClFNO4S and a molecular weight of 357.8 g/mol. IUPAC name: 2-[(3-chloro-4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid. InChIKey: NJWNKXRKNANWCI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13ClFNO4S
Molecular weight357.8 g/mol
IUPAC name2-[(3-chloro-4-fluorophenyl)sulfonylamino]-3-phenylpropanoic acid
InChIKeyNJWNKXRKNANWCI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)F)Cl

Computed by PubChem (NCBI)