CAS 1009-33-2 appears in our catalog under these names: 1-Chloro-4-(1-cyclopropylvinyl)benzene, 95%, 95%, 1-Chloro-4-(1-cyclopropylvinyl)benzene, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-4-(1-cyclopropylethenyl)benzene (CAS 1009-33-2) is a chemical compound with the molecular formula C11H11Cl and a molecular weight of 178.66 g/mol. IUPAC name: 1-chloro-4-(1-cyclopropylethenyl)benzene. InChIKey: OUHVUAYZJYDXBY-UHFFFAOYSA-N.
| Molecular formula | C11H11Cl |
|---|---|
| Molecular weight | 178.66 g/mol |
| IUPAC name | 1-chloro-4-(1-cyclopropylethenyl)benzene |
| InChIKey | OUHVUAYZJYDXBY-UHFFFAOYSA-N |
| SMILES | C=C(C1CC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)