CAS 100900-07-0 appears in our catalog under these names: 5-(2-Aminoethylamino)-1-naphthalenesulfonic acid sodium salt, 95%, 5-(2-Aminoethylamino)-1-naphthalenesulfonic acid sodium salt hydrate, 95%, N-(Aminoethyl)-5-naphthylamine-1-sulfonic Acid Sodium Salt, >95% (HPLC), EDANS sodium, 98%, Sodium 5–(2–Aminoethylamino)–1–naphthalenesulfonate Hydrate. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, TargetMol. Available pack sizes: 250mg, 1g, 10g, 500mg, 5g, 100mg, 5mg, 10mg.
Sodium 5-(2-aminoethylamino)naphthalene-1-sulfonate (CAS 100900-07-0) is a chemical compound with the molecular formula C12H13N2NaO3S and a molecular weight of 288.30 g/mol. IUPAC name: sodium 5-(2-aminoethylamino)naphthalene-1-sulfonate. InChIKey: HGWRACRQRUQQGH-UHFFFAOYSA-M.
| Molecular formula | C12H13N2NaO3S |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | sodium 5-(2-aminoethylamino)naphthalene-1-sulfonate |
| InChIKey | HGWRACRQRUQQGH-UHFFFAOYSA-M |
| SMILES | C1=CC2=C(C=CC=C2S(=O)(=O)[O-])C(=C1)NCCN.[Na+] |
Computed by PubChem (NCBI)