CAS 1009005-27-9 is the registry number for 3-(1H-Indol-3-yl)-2-{(4-(morpholine-4-sulfonyl)-2-nitrophenyl)amino}propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid (CAS 1009005-27-9) is a chemical compound with the molecular formula C21H22N4O7S and a molecular weight of 474.5 g/mol. IUPAC name: 3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid. InChIKey: OSRAXIOMKBPXNK-UHFFFAOYSA-N.
| Molecular formula | C21H22N4O7S |
|---|---|
| Molecular weight | 474.5 g/mol |
| IUPAC name | 3-(1H-indol-3-yl)-2-(4-morpholin-4-ylsulfonyl-2-nitroanilino)propanoic acid |
| InChIKey | OSRAXIOMKBPXNK-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC(=C(C=C2)NC(CC3=CNC4=CC=CC=C43)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)