CAS 1009262-71-8 appears in our catalog under these names: 2-(2,6-Dichlorobenzenesulfonamido)-4-(methylsulfanyl)butanoic acid, 95%, 2–(2,6–Dichlorobenzenesulfonamido)–4–(methylsulfanyl)butanoic acid. Offered by: AmBeed, GLPBio. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg.
2-[(2,6-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid (CAS 1009262-71-8) is a chemical compound with the molecular formula C11H13Cl2NO4S2 and a molecular weight of 358.3 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid. InChIKey: DNWPAUWVUOSNBE-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO4S2 |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| InChIKey | DNWPAUWVUOSNBE-UHFFFAOYSA-N |
| SMILES | CSCCC(C(=O)O)NS(=O)(=O)C1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)