CAS 100929-85-9 appears in our catalog under these names: 1-Naphthyl phosphate potassium salt/ 99.81% (existing batch purity), 1–Naphthyl phosphate potassium salt, 1-Naphthyl phosphate potassium salt, 1-Naphthyl phosphate (potassium salt). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 100mg, 250mg, 1g, 5g.
CAS 100929-85-9 identifies a chemical compound with the molecular formula C10H9KO4P and a molecular weight of 263.25 g/mol. InChIKey: NFAYDMOGJKWSMQ-UHFFFAOYSA-N.
| Molecular formula | C10H9KO4P |
|---|---|
| Molecular weight | 263.25 g/mol |
| InChIKey | NFAYDMOGJKWSMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OP(=O)(O)O.[K] |
Computed by PubChem (NCBI)