CAS 1009303-56-3 appears in our catalog under these names: 4-Fluoro-3-(tetrazol-5-yl)phenylboronic acid, 97%, 4-Fluoro-3-(tetrazol-5-yl)phenylboronic acid, 95%. Offered by: Combi-blocks, Thermo Scientific (Acros). Available pack sizes: 100mg, 1g.
[4-fluoro-3-(2H-tetrazol-5-yl)phenyl]boronic acid (CAS 1009303-56-3) is a chemical compound with the molecular formula C7H6BFN4O2 and a molecular weight of 207.96 g/mol. IUPAC name: [4-fluoro-3-(2H-tetrazol-5-yl)phenyl]boronic acid. InChIKey: FELFJHZMQYCKPT-UHFFFAOYSA-N.
| Molecular formula | C7H6BFN4O2 |
|---|---|
| Molecular weight | 207.96 g/mol |
| IUPAC name | [4-fluoro-3-(2H-tetrazol-5-yl)phenyl]boronic acid |
| InChIKey | FELFJHZMQYCKPT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)C2=NNN=N2)(O)O |
Computed by PubChem (NCBI)