Products 1009409-32-8
CAS 1009409-32-8 is the registry number for 2-(Methyl-d3-sulfonyl)-ethan-1,1,2,2-d4-amine. Offered by: TRC. Available pack sizes: 100mg.
1,1,2,2-tetradeuterio-2-(trideuteriomethylsulfonyl)ethanamine (CAS 1009409-32-8) is a chemical compound with the molecular formula C3H9NO2S and a molecular weight of 130.22 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(trideuteriomethylsulfonyl)ethanamine. InChIKey: SDNXQWUJWNTDCC-NCKGIQLSSA-N.
| Molecular formula | C3H9NO2S |
|---|---|
| Molecular weight | 130.22 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(trideuteriomethylsulfonyl)ethanamine |
| InChIKey | SDNXQWUJWNTDCC-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])S(=O)(=O)C([2H])([2H])C([2H])([2H])N |
Computed by PubChem (NCBI)