CAS 1009512-36-0 is the registry number for 2-{(2-chloro-5-(dimethylsulfamoyl)phenyl)formamido}-3-methylpentanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]-3-methylpentanoic acid (CAS 1009512-36-0) is a chemical compound with the molecular formula C15H21ClN2O5S and a molecular weight of 376.9 g/mol. IUPAC name: 2-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]-3-methylpentanoic acid. InChIKey: SMRDFIFPOUWYQZ-UHFFFAOYSA-N.
| Molecular formula | C15H21ClN2O5S |
|---|---|
| Molecular weight | 376.9 g/mol |
| IUPAC name | 2-[[2-chloro-5-(dimethylsulfamoyl)benzoyl]amino]-3-methylpentanoic acid |
| InChIKey | SMRDFIFPOUWYQZ-UHFFFAOYSA-N |
| SMILES | CCC(C)C(C(=O)O)NC(=O)C1=C(C=CC(=C1)S(=O)(=O)N(C)C)Cl |
Computed by PubChem (NCBI)