Products 1009562-97-3

CAS 1009562-97-3 is the registry number for N-Hydroxypyrimidine-5-carbimidoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

N-hydroxypyrimidine-5-carboximidoyl chloride (CAS 1009562-97-3) is a chemical compound with the molecular formula C5H4ClN3O and a molecular weight of 157.56 g/mol. IUPAC name: N-hydroxypyrimidine-5-carboximidoyl chloride. InChIKey: PJOBIIRRJYYUAA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4ClN3O
Molecular weight157.56 g/mol
IUPAC nameN-hydroxypyrimidine-5-carboximidoyl chloride
InChIKeyPJOBIIRRJYYUAA-UHFFFAOYSA-N
SMILESC1=C(C=NC=N1)C(=NO)Cl

Computed by PubChem (NCBI)