Products 1009576-98-0
CAS 1009576-98-0 is the registry number for tert-Butyl 4-(ethylsulfonyl)piperazine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 4-ethylsulfonylpiperazine-1-carboxylate (CAS 1009576-98-0) is a chemical compound with the molecular formula C11H22N2O4S and a molecular weight of 278.37 g/mol. IUPAC name: tert-butyl 4-ethylsulfonylpiperazine-1-carboxylate. InChIKey: QASNYIXXHODMFJ-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O4S |
|---|---|
| Molecular weight | 278.37 g/mol |
| IUPAC name | tert-butyl 4-ethylsulfonylpiperazine-1-carboxylate |
| InChIKey | QASNYIXXHODMFJ-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)