CAS 10099-74-8 appears in our catalog under these names: OŁOWIU AZOTAN 0,01mol/l, OŁOWIU AZOTAN 0,05mol/l, OŁOWIU AZOTAN 0,1mol/l, OŁOWIU AZOTAN 34%, OŁOWIU AZOTAN czda. Offered by: Tarchem, Chemat Brand, TRC, Paragon Scientific, Thermo Scientific (Alfa Aesar). Available pack sizes: 1l, 5l, 250g, on request, 10g, 25g, 900ml, 50g.
Lead(2+) dinitrate (CAS 10099-74-8) is a chemical compound with the molecular formula N2O6Pb and a molecular weight of 331 g/mol. IUPAC name: lead(2+) dinitrate. InChIKey: RLJMLMKIBZAXJO-UHFFFAOYSA-N.
| Molecular formula | N2O6Pb |
|---|---|
| Molecular weight | 331 g/mol |
| IUPAC name | lead(2+) dinitrate |
| InChIKey | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Pb+2] |
Computed by PubChem (NCBI)