CAS 10099-79-3 appears in our catalog under these names: Lead Vanadate, Lead vanadate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 50g.
Lead(2+);bis(oxido(dioxo)vanadium) (CAS 10099-79-3) is a chemical compound with the molecular formula O6PbV2 and a molecular weight of 405 g/mol. IUPAC name: lead(2+);bis(oxido(dioxo)vanadium). InChIKey: OGRLITDAVSILTM-UHFFFAOYSA-N.
| Molecular formula | O6PbV2 |
|---|---|
| Molecular weight | 405 g/mol |
| IUPAC name | lead(2+);bis(oxido(dioxo)vanadium) |
| InChIKey | OGRLITDAVSILTM-UHFFFAOYSA-N |
| SMILES | [O-][V](=O)=O.[O-][V](=O)=O.[Pb+2] |
Computed by PubChem (NCBI)