CAS 101-00-8 appears in our catalog under these names: Triisopropanolamine cyclic borate, 98%, 3,7,10-Trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo(3.3.3)undecane, 98%, triisopropanolamine cyclic borate, Triisopropanolamine Borate, Triisopropanolamine Borate, >98.0%(N). Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 25g, 1g, 100g, 500g, 10g, 15g, 50g.
3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane (CAS 101-00-8) is a chemical compound with the molecular formula C9H18BNO3 and a molecular weight of 199.06 g/mol. IUPAC name: 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane. InChIKey: IWKGJTDSJPLUCE-UHFFFAOYSA-N.
| Molecular formula | C9H18BNO3 |
|---|---|
| Molecular weight | 199.06 g/mol |
| IUPAC name | 3,7,10-trimethyl-2,8,9-trioxa-5-aza-1-borabicyclo[3.3.3]undecane |
| InChIKey | IWKGJTDSJPLUCE-UHFFFAOYSA-N |
| SMILES | B12OC(CN(CC(O1)C)CC(O2)C)C |
Computed by PubChem (NCBI)