CAS 101004-43-7 appears in our catalog under these names: (1,2-Dimethyl-1H-indol-5-yl)methanamine, 98%, (1,2-Dimethyl-1H-indol-5-yl)methanamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1,2-dimethylindol-5-yl)methanamine (CAS 101004-43-7) is a chemical compound with the molecular formula C11H14N2 and a molecular weight of 174.24 g/mol. IUPAC name: (1,2-dimethylindol-5-yl)methanamine. InChIKey: RBJKUVYKEPJFDP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | (1,2-dimethylindol-5-yl)methanamine |
| InChIKey | RBJKUVYKEPJFDP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C)C=CC(=C2)CN |
Computed by PubChem (NCBI)