CAS 1010411-21-8 appears in our catalog under these names: GSK369796 Dihydrochloride/ 98%, GSK369796 Dihydrochloride, GSK369796 Dihydrochloride, GSK369796 2HCl 99%, GSK369796 2HCl, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 2mg.
2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride (CAS 1010411-21-8) is a chemical compound with the molecular formula C20H24Cl3N3O and a molecular weight of 428.8 g/mol. IUPAC name: 2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride. InChIKey: UDVALKJFXQVZSI-UHFFFAOYSA-N.
| Molecular formula | C20H24Cl3N3O |
|---|---|
| Molecular weight | 428.8 g/mol |
| IUPAC name | 2-[(tert-butylamino)methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol;dihydrochloride |
| InChIKey | UDVALKJFXQVZSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC1=C(C=C(C=C1)NC2=C3C=CC(=CC3=NC=C2)Cl)O.Cl.Cl |
Computed by PubChem (NCBI)