CAS 101066-62-0 is the registry number for 1,1,1-Trifluoro-4-(trimethylsilyl)but-3-yn-2-one. Offered by: Biosynth. Available pack sizes: 0,1g.
1,1,1-trifluoro-4-trimethylsilylbut-3-yn-2-one (CAS 101066-62-0) is a chemical compound with the molecular formula C7H9F3OSi and a molecular weight of 194.23 g/mol. IUPAC name: 1,1,1-trifluoro-4-trimethylsilylbut-3-yn-2-one. InChIKey: PZFJPLDQLMDDSF-UHFFFAOYSA-N.
| Molecular formula | C7H9F3OSi |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 1,1,1-trifluoro-4-trimethylsilylbut-3-yn-2-one |
| InChIKey | PZFJPLDQLMDDSF-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)