CAS 101072-04-2 is the registry number for 8-Bromo-3-methyl-7-(2-oxo-2-phenylethyl)-1H-purine-2,6(3H,7H)-dione. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg.
8-bromo-3-methyl-7-phenacylpurine-2,6-dione (CAS 101072-04-2) is a chemical compound with the molecular formula C14H11BrN4O3 and a molecular weight of 363.17 g/mol. IUPAC name: 8-bromo-3-methyl-7-phenacylpurine-2,6-dione. InChIKey: MDRUDFVHNBRYOO-UHFFFAOYSA-N.
| Molecular formula | C14H11BrN4O3 |
|---|---|
| Molecular weight | 363.17 g/mol |
| IUPAC name | 8-bromo-3-methyl-7-phenacylpurine-2,6-dione |
| InChIKey | MDRUDFVHNBRYOO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)N(C(=N2)Br)CC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)