Products 101083-92-5
CAS 101083-92-5 appears in our catalog under these names: 5–Nitro–7–azaindole, 5-Nitro-7-azaindole, 5-Nitro-7-azaindole, 95%, 5-Nitro-1H-pyrrolo(2,3-b)pyridine, 5-Nitro-1H-pyrrolo[2,3-b]pyridine 97%. Offered by: GLPBio, Biosynth, Fluorochem, TRC, Ambeed. Available pack sizes: 1g, 5g, 0,25g, 0,5g, 2g, 250mg, 10g, 25g.
5-nitro-1H-pyrrolo[2,3-b]pyridine (CAS 101083-92-5) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 5-nitro-1H-pyrrolo[2,3-b]pyridine. InChIKey: INMIPMLIYKQQID-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 5-nitro-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | INMIPMLIYKQQID-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C=C21)[N+](=O)[O-] |
Computed by PubChem (NCBI)