CAS 101084-87-1 is the registry number for (2,4,6-trichlorophenyl)methanamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2,4,6-trichlorophenyl)methanamine;hydrochloride (CAS 101084-87-1) is a chemical compound with the molecular formula C7H7Cl4N and a molecular weight of 246.9 g/mol. IUPAC name: (2,4,6-trichlorophenyl)methanamine;hydrochloride. InChIKey: VYRMHBJCNKBFJW-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl4N |
|---|---|
| Molecular weight | 246.9 g/mol |
| IUPAC name | (2,4,6-trichlorophenyl)methanamine;hydrochloride |
| InChIKey | VYRMHBJCNKBFJW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CN)Cl)Cl.Cl |
Computed by PubChem (NCBI)