CAS 1010904-11-6 is the registry number for 4-(2,3-Difluorophenyl)-4,5,6,7-tetrahydro-3h-imidazo[4,5-c]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(2,3-difluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (CAS 1010904-11-6) is a chemical compound with the molecular formula C12H11F2N3 and a molecular weight of 235.23 g/mol. IUPAC name: 4-(2,3-difluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine. InChIKey: YYQNDNVIMIXJIY-UHFFFAOYSA-N.
| Molecular formula | C12H11F2N3 |
|---|---|
| Molecular weight | 235.23 g/mol |
| IUPAC name | 4-(2,3-difluorophenyl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
| InChIKey | YYQNDNVIMIXJIY-UHFFFAOYSA-N |
| SMILES | C1CNC(C2=C1NC=N2)C3=C(C(=CC=C3)F)F |
Computed by PubChem (NCBI)