CAS 1010916-57-0 is the registry number for ([(6,7-Dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl)methyl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methylsulfanyl]acetic acid (CAS 1010916-57-0) is a chemical compound with the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. IUPAC name: 2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methylsulfanyl]acetic acid. InChIKey: FRMMRJRZNGUTGV-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O5S |
|---|---|
| Molecular weight | 310.33 g/mol |
| IUPAC name | 2-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methylsulfanyl]acetic acid |
| InChIKey | FRMMRJRZNGUTGV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)NC(=N2)CSCC(=O)O)OC |
Computed by PubChem (NCBI)