CAS 10113-29-8 is the registry number for Tetrakis-benzyl-stannane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tetrabenzylstannane (CAS 10113-29-8) is a chemical compound with the molecular formula C28H28Sn and a molecular weight of 483.2 g/mol. IUPAC name: tetrabenzylstannane. InChIKey: WBVCLUDHJDTUAU-UHFFFAOYSA-N.
| Molecular formula | C28H28Sn |
|---|---|
| Molecular weight | 483.2 g/mol |
| IUPAC name | tetrabenzylstannane |
| InChIKey | WBVCLUDHJDTUAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[Sn](CC2=CC=CC=C2)(CC3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)