CAS 101130-35-2 is the registry number for (Methyl-d3) 2,5-Dihydroxybenzoate. Offered by: TRC. Available pack sizes: 100mg.
Trideuteriomethyl 2,5-dihydroxybenzoate (CAS 101130-35-2) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 171.16 g/mol. IUPAC name: trideuteriomethyl 2,5-dihydroxybenzoate. InChIKey: XGDPKUKRQHHZTH-FIBGUPNXSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | trideuteriomethyl 2,5-dihydroxybenzoate |
| InChIKey | XGDPKUKRQHHZTH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)C1=C(C=CC(=C1)O)O |
Computed by PubChem (NCBI)