CAS 1011396-95-4 is the registry number for 3-methyl-5-(trifluoromethyl)-2H-1,2,6-thiadiazine-1,1-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-methyl-5-(trifluoromethyl)-2H-1,2,6-thiadiazine 1,1-dioxide (CAS 1011396-95-4) is a chemical compound with the molecular formula C5H5F3N2O2S and a molecular weight of 214.17 g/mol. IUPAC name: 3-methyl-5-(trifluoromethyl)-2H-1,2,6-thiadiazine 1,1-dioxide. InChIKey: VSDVVKINVKLEOB-UHFFFAOYSA-N.
| Molecular formula | C5H5F3N2O2S |
|---|---|
| Molecular weight | 214.17 g/mol |
| IUPAC name | 3-methyl-5-(trifluoromethyl)-2H-1,2,6-thiadiazine 1,1-dioxide |
| InChIKey | VSDVVKINVKLEOB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NS(=O)(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)