CAS 10114-40-6 is the registry number for Acid Alizarin Blue BB. Offered by: TRC. Available pack sizes: 100mg.
Sodium 1,3,4,5,7,8-hexahydroxy-9,10-dioxoanthracene-2,6-disulfonic acid (CAS 10114-40-6) is a chemical compound with the molecular formula C14H8NaO14S2+ and a molecular weight of 487.3 g/mol. IUPAC name: sodium 1,3,4,5,7,8-hexahydroxy-9,10-dioxoanthracene-2,6-disulfonic acid. InChIKey: FKLILKHHYDFNFD-UHFFFAOYSA-N.
| Molecular formula | C14H8NaO14S2+ |
|---|---|
| Molecular weight | 487.3 g/mol |
| IUPAC name | sodium 1,3,4,5,7,8-hexahydroxy-9,10-dioxoanthracene-2,6-disulfonic acid |
| InChIKey | FKLILKHHYDFNFD-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C(C(=C1O)O)S(=O)(=O)O)O)C(=O)C3=C(C2=O)C(=C(C(=C3O)O)S(=O)(=O)O)O.[Na+] |
Computed by PubChem (NCBI)