CAS 1011482-37-3 is the registry number for 6-Chloro-4-oxo-2-spiro(n-boc-piperidine-4-yl)-benzopyran, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CAS 1011482-37-3) is a chemical compound with the molecular formula C18H22ClNO4 and a molecular weight of 351.8 g/mol. IUPAC name: tert-butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate. InChIKey: RUSWDSAVXRAHNN-UHFFFAOYSA-N.
| Molecular formula | C18H22ClNO4 |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | tert-butyl 6-chloro-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| InChIKey | RUSWDSAVXRAHNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)C3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)