CAS 1011482-38-4 is the registry number for (S)-N-(1-(2-(Diphenylphosphaneyl)phenyl)ethyl)-1,1-diphenylphosphanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-N-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethanamine (CAS 1011482-38-4) is a chemical compound with the molecular formula C32H29NP2 and a molecular weight of 489.5 g/mol. IUPAC name: (1S)-N-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethanamine. InChIKey: WYLFPAMRHWNREU-SANMLTNESA-N.
| Molecular formula | C32H29NP2 |
|---|---|
| Molecular weight | 489.5 g/mol |
| IUPAC name | (1S)-N-diphenylphosphanyl-1-(2-diphenylphosphanylphenyl)ethanamine |
| InChIKey | WYLFPAMRHWNREU-SANMLTNESA-N |
| SMILES | C[C@@H](C1=CC=CC=C1P(C2=CC=CC=C2)C3=CC=CC=C3)NP(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)