CAS 1011502-06-9 is the registry number for (2,5-Dimethylphenyl)(phenyl)iodonium triflate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
(2,5-dimethylphenyl)-(2-methylphenyl)iodanium;trifluoromethanesulfonate (CAS 1011502-06-9) is a chemical compound with the molecular formula C16H16F3IO3S and a molecular weight of 472.3 g/mol. IUPAC name: (2,5-dimethylphenyl)-(2-methylphenyl)iodanium;trifluoromethanesulfonate. InChIKey: LFYAAOMBOJTVPY-UHFFFAOYSA-M.
| Molecular formula | C16H16F3IO3S |
|---|---|
| Molecular weight | 472.3 g/mol |
| IUPAC name | (2,5-dimethylphenyl)-(2-methylphenyl)iodanium;trifluoromethanesulfonate |
| InChIKey | LFYAAOMBOJTVPY-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C=C1)C)[I+]C2=CC=CC=C2C.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)