CAS 1011502-15-0 is the registry number for (4-Trifluoromethylphenyl)(phenyl)iodonium triflate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g.
Phenyl-[4-(trifluoromethyl)phenyl]iodanium;trifluoromethanesulfonate (CAS 1011502-15-0) is a chemical compound with the molecular formula C14H9F6IO3S and a molecular weight of 498.18 g/mol. IUPAC name: phenyl-[4-(trifluoromethyl)phenyl]iodanium;trifluoromethanesulfonate. InChIKey: WHXDJSVPFVKGEU-UHFFFAOYSA-M.
| Molecular formula | C14H9F6IO3S |
|---|---|
| Molecular weight | 498.18 g/mol |
| IUPAC name | phenyl-[4-(trifluoromethyl)phenyl]iodanium;trifluoromethanesulfonate |
| InChIKey | WHXDJSVPFVKGEU-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(F)(F)F.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)