Products 1011737-61-3
CAS 1011737-61-3 is the registry number for 1-(4-Bromo-2-iodophenyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-bromo-2-iodophenyl)pyrrolidin-2-one (CAS 1011737-61-3) is a chemical compound with the molecular formula C10H9BrINO and a molecular weight of 365.99 g/mol. IUPAC name: 1-(4-bromo-2-iodophenyl)pyrrolidin-2-one. InChIKey: IEKHBFSJOKLUQI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrINO |
|---|---|
| Molecular weight | 365.99 g/mol |
| IUPAC name | 1-(4-bromo-2-iodophenyl)pyrrolidin-2-one |
| InChIKey | IEKHBFSJOKLUQI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=C(C=C2)Br)I |
Computed by PubChem (NCBI)