CAS 101187-39-7 appears in our catalog under these names: Azide-PEG4-Azide, 95%, Azido-PEG3-azide, Azide–PEG4–Azide, 1,11-Diazido-3,6,9-trioxaundecane, Ethane,1,1'-oxybis[2-(2-azidoethoxy)-, 98%, 98%. Offered by: Lumiprobe, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 1g, 25g, 5g, 25mg, 2000mg, 1000mg, 5000mg, 250000mg.
1-azido-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethane (CAS 101187-39-7) is a chemical compound with the molecular formula C8H16N6O3 and a molecular weight of 244.25 g/mol. IUPAC name: 1-azido-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethane. InChIKey: SFMMXKLNFMIUCH-UHFFFAOYSA-N.
| Molecular formula | C8H16N6O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 1-azido-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethane |
| InChIKey | SFMMXKLNFMIUCH-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCN=[N+]=[N-])N=[N+]=[N-] |
Computed by PubChem (NCBI)