CAS 101199-38-6 appears in our catalog under these names: Sodium 3-(10H-Phenothiazin-10-yl)propane-1-sulfonate, >95% (HPLC), PTZ-343/ 99.9%, PTZ–343, 10H-Phenothiazine-10-propanesulfonic acid sodium salt, PTZ-343 96%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 250mg, 500mg, 1g, 25mg, 50mg, 100mg, 2g, 5g.
Sodium 3-phenothiazin-10-ylpropane-1-sulfonate (CAS 101199-38-6) is a chemical compound with the molecular formula C15H14NNaO3S2 and a molecular weight of 343.4 g/mol. IUPAC name: sodium 3-phenothiazin-10-ylpropane-1-sulfonate. InChIKey: VKGYKXFNSKEHED-UHFFFAOYSA-M.
| Molecular formula | C15H14NNaO3S2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | sodium 3-phenothiazin-10-ylpropane-1-sulfonate |
| InChIKey | VKGYKXFNSKEHED-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)CCCS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)