CAS 1012075-54-5 is the registry number for 1,1'-((2,3,5,6-Tetramethyl-1,4-phenylene)bis(methylene))bis(1H-imidazole), 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[4-(imidazol-1-ylmethyl)-2,3,5,6-tetramethylphenyl]methyl]imidazole (CAS 1012075-54-5) is a chemical compound with the molecular formula C18H22N4 and a molecular weight of 294.4 g/mol. IUPAC name: 1-[[4-(imidazol-1-ylmethyl)-2,3,5,6-tetramethylphenyl]methyl]imidazole. InChIKey: UIANYESDIYVJNS-UHFFFAOYSA-N.
| Molecular formula | C18H22N4 |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | 1-[[4-(imidazol-1-ylmethyl)-2,3,5,6-tetramethylphenyl]methyl]imidazole |
| InChIKey | UIANYESDIYVJNS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1CN2C=CN=C2)C)C)CN3C=CN=C3)C |
Computed by PubChem (NCBI)