CAS 1012085-48-1 is the registry number for 3,5-Pyridine diboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(5-borono-3-pyridinyl)boronic acid (CAS 1012085-48-1) is a chemical compound with the molecular formula C5H7B2NO4 and a molecular weight of 166.74 g/mol. IUPAC name: (5-borono-3-pyridinyl)boronic acid. InChIKey: NZUCYVVWSUZTQZ-UHFFFAOYSA-N.
| Molecular formula | C5H7B2NO4 |
|---|---|
| Molecular weight | 166.74 g/mol |
| IUPAC name | (5-borono-3-pyridinyl)boronic acid |
| InChIKey | NZUCYVVWSUZTQZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)B(O)O)(O)O |
Computed by PubChem (NCBI)