Products 1012085-48-1

CAS 1012085-48-1 is the registry number for 3,5-Pyridine diboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(5-borono-3-pyridinyl)boronic acid (CAS 1012085-48-1) is a chemical compound with the molecular formula C5H7B2NO4 and a molecular weight of 166.74 g/mol. IUPAC name: (5-borono-3-pyridinyl)boronic acid. InChIKey: NZUCYVVWSUZTQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7B2NO4
Molecular weight166.74 g/mol
IUPAC name(5-borono-3-pyridinyl)boronic acid
InChIKeyNZUCYVVWSUZTQZ-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1)B(O)O)(O)O

Computed by PubChem (NCBI)