Products 1012205-70-7
CAS 1012205-70-7 is the registry number for Urease-IN-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(2,6-dichloroanilino)phenyl]-N-(4-sulfamoylphenyl)acetamide (CAS 1012205-70-7) is a chemical compound with the molecular formula C20H17Cl2N3O3S and a molecular weight of 450.3 g/mol. IUPAC name: 2-[2-(2,6-dichloroanilino)phenyl]-N-(4-sulfamoylphenyl)acetamide. InChIKey: TZWKNAVYTUOLLG-UHFFFAOYSA-N.
| Molecular formula | C20H17Cl2N3O3S |
|---|---|
| Molecular weight | 450.3 g/mol |
| IUPAC name | 2-[2-(2,6-dichloroanilino)phenyl]-N-(4-sulfamoylphenyl)acetamide |
| InChIKey | TZWKNAVYTUOLLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NC2=CC=C(C=C2)S(=O)(=O)N)NC3=C(C=CC=C3Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Urease-IN-10, orb2565092