CAS 1012484-29-5 is the registry number for 5-Bromo-2-fluoro-N-((tetrahydrofuran-2-yl)methyl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-2-fluoro-N-(oxolan-2-ylmethyl)benzamide (CAS 1012484-29-5) is a chemical compound with the molecular formula C12H13BrFNO2 and a molecular weight of 302.14 g/mol. IUPAC name: 5-bromo-2-fluoro-N-(oxolan-2-ylmethyl)benzamide. InChIKey: GQQHBAQZBXZBBD-UHFFFAOYSA-N.
| Molecular formula | C12H13BrFNO2 |
|---|---|
| Molecular weight | 302.14 g/mol |
| IUPAC name | 5-bromo-2-fluoro-N-(oxolan-2-ylmethyl)benzamide |
| InChIKey | GQQHBAQZBXZBBD-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CNC(=O)C2=C(C=CC(=C2)Br)F |
Computed by PubChem (NCBI)