CAS 101252-73-7 appears in our catalog under these names: (2–Chloro–6–nitrophenyl)methanamine, (2-Chloro-6-nitrophenyl)methanamine 95%, (2-Chloro-6-nitrophenyl)methanamine, 95%, 95%, (2-Chloro-6-nitrophenyl)methanamine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2-chloro-6-nitrophenyl)methanamine (CAS 101252-73-7) is a chemical compound with the molecular formula C7H7ClN2O2 and a molecular weight of 186.59 g/mol. IUPAC name: (2-chloro-6-nitrophenyl)methanamine. InChIKey: SPLDTOFRTGVWKF-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O2 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | (2-chloro-6-nitrophenyl)methanamine |
| InChIKey | SPLDTOFRTGVWKF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CN)[N+](=O)[O-] |
Computed by PubChem (NCBI)