CAS 1012836-59-7 is the registry number for 6,11-Dibromo-1,4-diazatriphenylene, 95%. Offered by: Combi-blocks, Thermo Scientific (Acros). Available pack sizes: 250mg, 1g.
6,11-dibromophenanthro[9,10-b]pyrazine (CAS 1012836-59-7) is a chemical compound with the molecular formula C16H8Br2N2 and a molecular weight of 388.06 g/mol. IUPAC name: 6,11-dibromophenanthro[9,10-b]pyrazine. InChIKey: PODXMJZWPPXECD-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2N2 |
|---|---|
| Molecular weight | 388.06 g/mol |
| IUPAC name | 6,11-dibromophenanthro[9,10-b]pyrazine |
| InChIKey | PODXMJZWPPXECD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=NC=CN=C3C4=C2C=CC(=C4)Br |
Computed by PubChem (NCBI)