CAS 1013213-84-7 appears in our catalog under these names: Carbonic anhydrase inhibitor 6/ 98.81% (existing batch purity), 2-(3,4-dimethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide, Carbonic anhydrase inhibitor 6. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 200mg.
2-(3,4-dimethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide (CAS 1013213-84-7) is a chemical compound with the molecular formula C26H25N3O5S and a molecular weight of 491.6 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide. InChIKey: HLSPYEFIWCWUBB-UHFFFAOYSA-N.
| Molecular formula | C26H25N3O5S |
|---|---|
| Molecular weight | 491.6 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]quinoline-4-carboxamide |
| InChIKey | HLSPYEFIWCWUBB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)NCCC4=CC=C(C=C4)S(=O)(=O)N)OC |
Computed by PubChem (NCBI)