CAS 10135-38-3 appears in our catalog under these names: 3,3,5,5-Tetramethyl-1-pyrroline n-oxide, 95%, 3,3,5,5–Tetramethyl–1–pyrroline N–Oxide, 3,3,5,5-Tetramethyl-1-pyrroline N-Oxide, >98.0%(GC), 3,3,5,5-Tetramethyl-1-pyrroline N-Oxide, ≥98%(GC), ≥98%(GC), TMPO. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 100mg, 50mg, Get quote.
2,2,4,4-tetramethyl-1-oxido-3H-pyrrol-1-ium (CAS 10135-38-3) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: 2,2,4,4-tetramethyl-1-oxido-3H-pyrrol-1-ium. InChIKey: GUQARRULARNYQZ-UHFFFAOYSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | 2,2,4,4-tetramethyl-1-oxido-3H-pyrrol-1-ium |
| InChIKey | GUQARRULARNYQZ-UHFFFAOYSA-N |
| SMILES | CC1(CC([N+](=C1)[O-])(C)C)C |
Computed by PubChem (NCBI)