CAS 101385-69-7 appears in our catalog under these names: 2–Chloro–1,3–dimethylimidazolidinium hexafluorophosphate, 2-Chloro-1,3-dimethylimidazolinium Hexafluorophosphate, >98.0%(HPLC)(T), CIP 97%, 2-CHLORO-1,3-DIMETHYL-2-IMIDAZOLINIUM &, 2-Chloro-4,5-dihydro-1,3-dimethyl-1H-imidazolium hexafluorophosphate, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g, 1000g.
2-chloro-1,3-dimethyl-4,5-dihydroimidazol-1-ium hexafluorophosphate (CAS 101385-69-7) is a chemical compound with the molecular formula C5H10ClF6N2P and a molecular weight of 278.56 g/mol. IUPAC name: 2-chloro-1,3-dimethyl-4,5-dihydroimidazol-1-ium hexafluorophosphate. InChIKey: CNAKHAGVVMOXFE-UHFFFAOYSA-N.
| Molecular formula | C5H10ClF6N2P |
|---|---|
| Molecular weight | 278.56 g/mol |
| IUPAC name | 2-chloro-1,3-dimethyl-4,5-dihydroimidazol-1-ium hexafluorophosphate |
| InChIKey | CNAKHAGVVMOXFE-UHFFFAOYSA-N |
| SMILES | CN1CC[N+](=C1Cl)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)