Products 101396-42-3
CAS 101396-42-3 is the registry number for Mequitamium (iodide). Offered by: MedChemExpress. Available pack sizes: Get quote.
10-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)methyl]phenothiazine iodide (CAS 101396-42-3) is a chemical compound with the molecular formula C21H25IN2S and a molecular weight of 464.4 g/mol. IUPAC name: 10-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)methyl]phenothiazine iodide. InChIKey: SWVANDLDSRKJFI-UHFFFAOYSA-M.
| Molecular formula | C21H25IN2S |
|---|---|
| Molecular weight | 464.4 g/mol |
| IUPAC name | 10-[(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)methyl]phenothiazine iodide |
| InChIKey | SWVANDLDSRKJFI-UHFFFAOYSA-M |
| SMILES | C[N+]12CCC(CC1)C(C2)CN3C4=CC=CC=C4SC5=CC=CC=C53.[I-] |
Computed by PubChem (NCBI)