CAS 1014010-73-1 is the registry number for 7-Butyl-3-methyl-8-(3,4,5-trimethyl-1H-pyrazol-1-yl)-1H-purine-2,6(3H,7H)-dione. Offered by: Biosynth. Available pack sizes: 5000mg.
7-butyl-3-methyl-8-(3,4,5-trimethylpyrazol-1-yl)purine-2,6-dione (CAS 1014010-73-1) is a chemical compound with the molecular formula C16H22N6O2 and a molecular weight of 330.38 g/mol. IUPAC name: 7-butyl-3-methyl-8-(3,4,5-trimethylpyrazol-1-yl)purine-2,6-dione. InChIKey: JBRAVSKWVHUJMW-UHFFFAOYSA-N.
| Molecular formula | C16H22N6O2 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | 7-butyl-3-methyl-8-(3,4,5-trimethylpyrazol-1-yl)purine-2,6-dione |
| InChIKey | JBRAVSKWVHUJMW-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=C(N=C1N3C(=C(C(=N3)C)C)C)N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)