CAS 1014020-08-6 is the registry number for 5-Amino-1-(3-(trifluoromethyl)phenyl)-1H-pyrazole-4-carboxamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-amino-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (CAS 1014020-08-6) is a chemical compound with the molecular formula C11H9F3N4O and a molecular weight of 270.21 g/mol. IUPAC name: 5-amino-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide. InChIKey: VORHMOHTJGBVAW-UHFFFAOYSA-N.
| Molecular formula | C11H9F3N4O |
|---|---|
| Molecular weight | 270.21 g/mol |
| IUPAC name | 5-amino-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| InChIKey | VORHMOHTJGBVAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=C(C=N2)C(=O)N)N)C(F)(F)F |
Computed by PubChem (NCBI)