Products 1014072-84-4
CAS 1014072-84-4 is the registry number for 7-Allyl-8-(3,5-dimethyl-1H-pyrazol-1-yl)-3-methyl-1H-purine-2,6(3H,7H)-dione. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
8-(3,5-dimethylpyrazol-1-yl)-3-methyl-7-prop-2-enylpurine-2,6-dione (CAS 1014072-84-4) is a chemical compound with the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. IUPAC name: 8-(3,5-dimethylpyrazol-1-yl)-3-methyl-7-prop-2-enylpurine-2,6-dione. InChIKey: YBUXYZXJSWPUBA-UHFFFAOYSA-N.
| Molecular formula | C14H16N6O2 |
|---|---|
| Molecular weight | 300.32 g/mol |
| IUPAC name | 8-(3,5-dimethylpyrazol-1-yl)-3-methyl-7-prop-2-enylpurine-2,6-dione |
| InChIKey | YBUXYZXJSWPUBA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=NC3=C(N2CC=C)C(=O)NC(=O)N3C)C |
Computed by PubChem (NCBI)