CAS 1014081-92-5 is the registry number for (4R)-2-(2,5-Difluorophenyl)-1,3-thiazolidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4R)-2-(2,5-difluorophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 1014081-92-5) is a chemical compound with the molecular formula C10H9F2NO2S and a molecular weight of 245.25 g/mol. IUPAC name: (4R)-2-(2,5-difluorophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: MYTWAZGPELUBSV-IENPIDJESA-N.
| Molecular formula | C10H9F2NO2S |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | (4R)-2-(2,5-difluorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | MYTWAZGPELUBSV-IENPIDJESA-N |
| SMILES | C1[C@H](NC(S1)C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)