Products 101416-22-2
CAS 101416-22-2 is the registry number for 5-(2-(Bis(phenylmethyl)amino)-1-hydroxyethyl)-2-hydroxybenzamide. Offered by: TRC. Available pack sizes: 500mg.
5-[2-(dibenzylamino)-1-hydroxyethyl]-2-hydroxybenzamide (CAS 101416-22-2) is a chemical compound with the molecular formula C23H24N2O3 and a molecular weight of 376.4 g/mol. IUPAC name: 5-[2-(dibenzylamino)-1-hydroxyethyl]-2-hydroxybenzamide. InChIKey: ZTDBXMQICLBDSR-UHFFFAOYSA-N.
| Molecular formula | C23H24N2O3 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 5-[2-(dibenzylamino)-1-hydroxyethyl]-2-hydroxybenzamide |
| InChIKey | ZTDBXMQICLBDSR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)CC(C3=CC(=C(C=C3)O)C(=O)N)O |
Computed by PubChem (NCBI)