CAS 101421-03-8 appears in our catalog under these names: 2,4-Dichloro-5-nitrobenzamide, 95%, 2,4-Dichloro-5-nitrobenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,4-dichloro-5-nitrobenzamide (CAS 101421-03-8) is a chemical compound with the molecular formula C7H4Cl2N2O3 and a molecular weight of 235.02 g/mol. IUPAC name: 2,4-dichloro-5-nitrobenzamide. InChIKey: KJEXYZTZEXYFLL-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O3 |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 2,4-dichloro-5-nitrobenzamide |
| InChIKey | KJEXYZTZEXYFLL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)