CAS 1014613-47-8 is the registry number for (2-(Trifluoromethyl)-1H-pyrrolo(2,3-b)pyridin-4-yl)boronic acid, 98+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
[2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid (CAS 1014613-47-8) is a chemical compound with the molecular formula C8H6BF3N2O2 and a molecular weight of 229.95 g/mol. IUPAC name: [2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid. InChIKey: BTUZSFNLLAAGQP-UHFFFAOYSA-N.
| Molecular formula | C8H6BF3N2O2 |
|---|---|
| Molecular weight | 229.95 g/mol |
| IUPAC name | [2-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]boronic acid |
| InChIKey | BTUZSFNLLAAGQP-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=C(NC2=NC=C1)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)